C15H16FN3O3S — CID 71201294
(5R)-5-(diazenylmethyl)-3-[3-fluoro-4-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 71201294) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is (5R)-5-(diazenylmethyl)-3-[3-fluoro-4-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(diazenylmethyl)-3-[3-fluoro-4-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71201294 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (5R)-5-(diazenylmethyl)-3-[3-fluoro-4-(1-oxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [H]/N=N/C[C@H]1CN(c2ccc(C3=CCS(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H16FN3O3S/c16-14-7-11(19-9-12(8-18-17)22-15(19)20)1-2-13(14)10-3-5-23(21)6-4-10/h1-3,7,12,17H,4-6,8-9H2/b18-17+/t12-,23?/m0/s1 |
| InChIKey | SDUPWEHIXKDROY-GOYAKBMCSA-N |
| XLogP | 2.72 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|