C21H17ClF3N7O2 — CID 71201855
methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-N-methylcarbamate (PubChem CID 71201855) has the molecular formula C21H17ClF3N7O2 and a molecular weight of 491.86 g/mol. Its IUPAC name is methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-N-methylcarbamate.
| Compound Name | methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 71201855 |
| Molecular Formula | C21H17ClF3N7O2 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1c(N)nc(-n2nc(Cc3c(F)ccc(F)c3F)c3cc(Cl)ccc32)nc1N |
| InChI | InChI=1S/C21H17ClF3N7O2/c1-31(21(33)34-2)17-18(26)28-20(29-19(17)27)32-15-6-3-9(22)7-11(15)14(30-32)8-10-12(23)4-5-13(24)16(10)25/h3-7H,8H2,1-2H3,(H4,26,27,28,29) |
| InChIKey | AHIHSUTZHZEZJO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|