C20H21ClO6 — CID 71202907
3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propyl 2-chloro-5-methylbenzoate (PubChem CID 71202907) has the molecular formula C20H21ClO6 and a molecular weight of 392.84 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propyl 2-chloro-5-methylbenzoate.
| Compound Name | 3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propyl 2-chloro-5-methylbenzoate |
|---|---|
| PubChem CID | 71202907 |
| Molecular Formula | C20H21ClO6 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propyl 2-chloro-5-methylbenzoate |
| SMILES | COc1c(CCCOC(=O)c2cc(C)ccc2Cl)cc2c(c1OC)OCO2 |
| InChI | InChI=1S/C20H21ClO6/c1-12-6-7-15(21)14(9-12)20(22)25-8-4-5-13-10-16-18(27-11-26-16)19(24-3)17(13)23-2/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | RLEPXJQJNOTICI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|