C23H17F3N2O4 — CID 71212145
5-pyridin-3-yl-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid (PubChem CID 71212145) has the molecular formula C23H17F3N2O4 and a molecular weight of 442.39 g/mol. Its IUPAC name is 5-pyridin-3-yl-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid.
| Compound Name | 5-pyridin-3-yl-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 71212145 |
| Molecular Formula | C23H17F3N2O4 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 5-pyridin-3-yl-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(-c3cccnc3)ccc2n1CCOc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N2O4/c24-23(25,26)32-19-6-4-18(5-7-19)31-11-10-28-20-8-3-15(16-2-1-9-27-14-16)12-17(20)13-21(28)22(29)30/h1-9,12-14H,10-11H2,(H,29,30) |
| InChIKey | ABDNGOJRJMGYNZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |