About 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid
5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid (PubChem CID 71212124) has the molecular formula C21H15F3N2O4S
and a molecular weight of 448.42 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid |
| PubChem CID | 71212124 |
| Molecular Formula | C21H15F3N2O4S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(-c3nccs3)ccc2n1CCOc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15F3N2O4S/c22-21(23,24)30-16-4-2-15(3-5-16)29-9-8-26-17-6-1-13(19-25-7-10-31-19)11-14(17)12-18(26)20(27)28/h1-7,10-12H,8-9H2,(H,27,28) |
| InChIKey | NCKIQSQUUDXLLZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid?
The IUPAC name of 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid (CID 71212124) is 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid.
What is the SMILES notation for 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid?
The canonical SMILES for 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid is O=C(O)c1cc2cc(-c3nccs3)ccc2n1CCOc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid?
The InChIKey is NCKIQSQUUDXLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N2O4S/c22-21(23,24)30-16-4-2-15(3-5-16)29-9-8-26-17-6-1-13(19-25-7-10-31-19)11-14(17)12-18(26)20(27)28/h1-7,10-12H,8-9H2,(H,27,28).
What are the key properties of 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid?
5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid has a molecular weight of 448.42 g/mol, XLogP of 5.44, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-yl)-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]indole-2-carboxylic acid is sourced from PubChem (CID 71212124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).