C17H12ClF3N2O4 — CID 89376018
4-chloro-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolo[3,2-c]pyridine-2-carboxylic acid (PubChem CID 89376018) has the molecular formula C17H12ClF3N2O4 and a molecular weight of 400.74 g/mol. Its IUPAC name is 4-chloro-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolo[3,2-c]pyridine-2-carboxylic acid.
| Compound Name | 4-chloro-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolo[3,2-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 89376018 |
| Molecular Formula | C17H12ClF3N2O4 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-chloro-1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolo[3,2-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(Cl)nccc2n1CCOc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O4/c18-15-12-9-14(16(24)25)23(13(12)5-6-22-15)7-8-26-10-1-3-11(4-2-10)27-17(19,20)21/h1-6,9H,7-8H2,(H,24,25) |
| InChIKey | JWVKDSLYDXWIPW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|