C26H31N5O4S — CID 71216557
3,4,5-trimethoxy-N-[2-[3-(piperazin-1-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide (PubChem CID 71216557) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[3-(piperazin-1-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[3-(piperazin-1-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 71216557 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[3-(piperazin-1-ylmethyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C2CN3C(CN4CCNCC4)=CSC3=N2)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N5O4S/c1-33-22-12-17(13-23(34-2)24(22)35-3)25(32)28-20-7-5-4-6-19(20)21-15-31-18(16-36-26(31)29-21)14-30-10-8-27-9-11-30/h4-7,12-13,16,21,27H,8-11,14-15H2,1-3H3,(H,28,32) |
| InChIKey | NAZYACSXGWJEJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |