C17H13FN2O3 — CID 71220947
N-[7-fluoro-6-(2-oxopropyl)-1,3-benzoxazol-2-yl]benzamide (PubChem CID 71220947) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is N-[7-fluoro-6-(2-oxopropyl)-1,3-benzoxazol-2-yl]benzamide.
| Compound Name | N-[7-fluoro-6-(2-oxopropyl)-1,3-benzoxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 71220947 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[7-fluoro-6-(2-oxopropyl)-1,3-benzoxazol-2-yl]benzamide |
| SMILES | CC(=O)Cc1ccc2nc(NC(=O)c3ccccc3)oc2c1F |
| InChI | InChI=1S/C17H13FN2O3/c1-10(21)9-12-7-8-13-15(14(12)18)23-17(19-13)20-16(22)11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,19,20,22) |
| InChIKey | ZTRJJZPDWGBPFF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |