[2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid

C13H12BFO3 — CID 71224966

IUPAC[2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid
SMILESCOc1ccc(-c2ccc(B(O)O)c(F)c2)cc1
InChIInChI=1S/C13H12BFO3/c1-18-11-5-2-9(3-6-11)10-4-7-12(14(16)17)13(15)8-10/h2-8,16-17H,1H3
InChIKeyHDYFKHWPDOSERI-UHFFFAOYSA-N
MW246.05 g/mol
LogP1.18
Rot. Bonds3

About [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid

[2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid (PubChem CID 71224966) has the molecular formula C13H12BFO3 and a molecular weight of 246.05 g/mol. Its IUPAC name is [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid
PubChem CID71224966
Molecular FormulaC13H12BFO3
Molecular Weight246.05 g/mol
Exact Mass246.09
IUPAC Name[2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid
SMILESCOc1ccc(-c2ccc(B(O)O)c(F)c2)cc1
InChIInChI=1S/C13H12BFO3/c1-18-11-5-2-9(3-6-11)10-4-7-12(14(16)17)13(15)8-10/h2-8,16-17H,1H3
InChIKeyHDYFKHWPDOSERI-UHFFFAOYSA-N
XLogP1.18
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.05
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid?
The IUPAC name of [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid (CID 71224966) is [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid.
What is the SMILES notation for [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid?
The canonical SMILES for [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid is COc1ccc(-c2ccc(B(O)O)c(F)c2)cc1.
What is the InChIKey of [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid?
The InChIKey is HDYFKHWPDOSERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BFO3/c1-18-11-5-2-9(3-6-11)10-4-7-12(14(16)17)13(15)8-10/h2-8,16-17H,1H3.
What are the key properties of [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid?
[2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid has a molecular weight of 246.05 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-4-(4-methoxyphenyl)phenyl]boronic acid is sourced from PubChem (CID 71224966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).