C19H32N2O5Si — CID 71225263
1-trimethylsilylethyl N-[(2R)-1-hydroxy-5-(phenylmethoxycarbonylamino)pentan-2-yl]carbamate (PubChem CID 71225263) has the molecular formula C19H32N2O5Si and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-trimethylsilylethyl N-[(2R)-1-hydroxy-5-(phenylmethoxycarbonylamino)pentan-2-yl]carbamate.
| Compound Name | 1-trimethylsilylethyl N-[(2R)-1-hydroxy-5-(phenylmethoxycarbonylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 71225263 |
| Molecular Formula | C19H32N2O5Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-trimethylsilylethyl N-[(2R)-1-hydroxy-5-(phenylmethoxycarbonylamino)pentan-2-yl]carbamate |
| SMILES | CC(OC(=O)N[C@@H](CO)CCCNC(=O)OCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C19H32N2O5Si/c1-15(27(2,3)4)26-19(24)21-17(13-22)11-8-12-20-18(23)25-14-16-9-6-5-7-10-16/h5-7,9-10,15,17,22H,8,11-14H2,1-4H3,(H,20,23)(H,21,24)/t15?,17-/m1/s1 |
| InChIKey | SQCYENPEAWWIJS-OMOCHNIRSA-N |
| XLogP | 3.05 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|