C18H36O2 — CID 71225455
2,4-diethyl-2,4-bis(3-methylbutyl)cyclobutane-1,3-diol (PubChem CID 71225455) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 2,4-diethyl-2,4-bis(3-methylbutyl)cyclobutane-1,3-diol.
| Compound Name | 2,4-diethyl-2,4-bis(3-methylbutyl)cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 71225455 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 2,4-diethyl-2,4-bis(3-methylbutyl)cyclobutane-1,3-diol |
| SMILES | CCC1(CCC(C)C)C(O)C(CC)(CCC(C)C)C1O |
| InChI | InChI=1S/C18H36O2/c1-7-17(11-9-13(3)4)15(19)18(8-2,16(17)20)12-10-14(5)6/h13-16,19-20H,7-12H2,1-6H3 |
| InChIKey | DBAOJARWLIHQOP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |