C25H27FN2O — CID 7122696
N-[(3S,7S,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-2-fluorobenzamide (PubChem CID 7122696) has the molecular formula C25H27FN2O and a molecular weight of 390.50 g/mol. Its IUPAC name is N-[(3S,7S,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-2-fluorobenzamide.
| Compound Name | N-[(3S,7S,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 7122696 |
| Molecular Formula | C25H27FN2O |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[(3S,7S,13R,17S)-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-trien-10-yl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cc2c3c(c1)[C@@H]1CCC[C@@H]1CN3C[C@H]1CCC[C@H]21)c1ccccc1F |
| InChI | InChI=1S/C25H27FN2O/c26-23-10-2-1-7-20(23)25(29)27-17-11-21-18-8-3-5-15(18)13-28-14-16-6-4-9-19(16)22(12-17)24(21)28/h1-2,7,10-12,15-16,18-19H,3-6,8-9,13-14H2,(H,27,29)/t15-,16-,18-,19+/m1/s1 |
| InChIKey | FKCIAEGKLRHTPA-RWQQGDIJSA-N |
| XLogP | 5.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|