C17H31NO2 — CID 71227673
(1S,2R,3Z,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol (PubChem CID 71227673) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (1S,2R,3Z,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol.
| Compound Name | (1S,2R,3Z,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol |
|---|---|
| PubChem CID | 71227673 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (1S,2R,3Z,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol |
| SMILES | CO[C@H]1/C=C/CCCCC(N)CC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H31NO2/c1-13-10-11-15(18)8-6-4-5-7-9-16(20-3)17(19)14(2)12-13/h7,9,12,14-17,19H,4-6,8,10-11,18H2,1-3H3/b9-7+,13-12-/t14-,15?,16+,17+/m1/s1 |
| InChIKey | YBJHOEGCAOEHJN-FZCFPHMESA-N |
| XLogP | 3.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|