C21H20F4N4O — CID 71237267
1-[[2-cyclopentyl-4-(trifluoromethyl)phenyl]methyl]-3-(6-fluoro-1H-indazol-4-yl)urea (PubChem CID 71237267) has the molecular formula C21H20F4N4O and a molecular weight of 420.41 g/mol. Its IUPAC name is 1-[[2-cyclopentyl-4-(trifluoromethyl)phenyl]methyl]-3-(6-fluoro-1H-indazol-4-yl)urea.
| Compound Name | 1-[[2-cyclopentyl-4-(trifluoromethyl)phenyl]methyl]-3-(6-fluoro-1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 71237267 |
| Molecular Formula | C21H20F4N4O |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-[[2-cyclopentyl-4-(trifluoromethyl)phenyl]methyl]-3-(6-fluoro-1H-indazol-4-yl)urea |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1C1CCCC1)Nc1cc(F)cc2[nH]ncc12 |
| InChI | InChI=1S/C21H20F4N4O/c22-15-8-18(17-11-27-29-19(17)9-15)28-20(30)26-10-13-5-6-14(21(23,24)25)7-16(13)12-3-1-2-4-12/h5-9,11-12H,1-4,10H2,(H,27,29)(H2,26,28,30) |
| InChIKey | RLUCGKTWCNPXBB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |