C26H28N4O3 — CID 71243505
3-[3-(3-aminopropoxy)-5-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]phenyl]-4-methyl-1H-pyridin-2-one (PubChem CID 71243505) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-[3-(3-aminopropoxy)-5-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]phenyl]-4-methyl-1H-pyridin-2-one.
| Compound Name | 3-[3-(3-aminopropoxy)-5-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]phenyl]-4-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71243505 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-[3-(3-aminopropoxy)-5-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]phenyl]-4-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C)cc(Nc2ncc(-c3cc(OCCCN)cc(-c4c(C)cc[nH]c4=O)c3)o2)c1 |
| InChI | InChI=1S/C26H28N4O3/c1-16-9-17(2)11-21(10-16)30-26-29-15-23(33-26)19-12-20(14-22(13-19)32-8-4-6-27)24-18(3)5-7-28-25(24)31/h5,7,9-15H,4,6,8,27H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | YSNATNSQQTZRIA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|