C16H15ClN2O2 — CID 11231939
N-(2-methoxyphenyl)-5-phenyl-1,3-oxazol-2-amine;hydrochloride (PubChem CID 11231939) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-5-phenyl-1,3-oxazol-2-amine;hydrochloride.
| Compound Name | N-(2-methoxyphenyl)-5-phenyl-1,3-oxazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 11231939 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(2-methoxyphenyl)-5-phenyl-1,3-oxazol-2-amine;hydrochloride |
| SMILES | COc1ccccc1Nc1ncc(-c2ccccc2)o1.Cl |
| InChI | InChI=1S/C16H14N2O2.ClH/c1-19-14-10-6-5-9-13(14)18-16-17-11-15(20-16)12-7-3-2-4-8-12;/h2-11H,1H3,(H,17,18);1H |
| InChIKey | IHXLWHUWFVFLCY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |