C21H21Cl2F2N3O5 — CID 71254931
N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[4-[(2-oxooxolan-3-yl)amino]butoxy]benzamide (PubChem CID 71254931) has the molecular formula C21H21Cl2F2N3O5 and a molecular weight of 504.32 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[4-[(2-oxooxolan-3-yl)amino]butoxy]benzamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[4-[(2-oxooxolan-3-yl)amino]butoxy]benzamide |
|---|---|
| PubChem CID | 71254931 |
| Molecular Formula | C21H21Cl2F2N3O5 |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[4-[(2-oxooxolan-3-yl)amino]butoxy]benzamide |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCCCCNC2CCOC2=O)c1 |
| InChI | InChI=1S/C21H21Cl2F2N3O5/c22-13-10-26-11-14(23)18(13)28-19(29)12-3-4-16(33-21(24)25)17(9-12)31-7-2-1-6-27-15-5-8-32-20(15)30/h3-4,9-11,15,21,27H,1-2,5-8H2,(H,26,28,29) |
| InChIKey | DXCZVUGSWTZEKE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|