C11H15NO7 — CID 71256532
(7aR)-2-methyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid (PubChem CID 71256532) has the molecular formula C11H15NO7 and a molecular weight of 273.24 g/mol. Its IUPAC name is (7aR)-2-methyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid.
| Compound Name | (7aR)-2-methyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 71256532 |
| Molecular Formula | C11H15NO7 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (7aR)-2-methyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid |
| SMILES | CC1=NC2C([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@H]2O1 |
| InChI | InChI=1S/C11H15NO7/c1-4-12-8-6(18-4)2-7(11(16)17)19-10(8)9(15)5(14)3-13/h2,5-6,8-10,13-15H,3H2,1H3,(H,16,17)/t5-,6-,8?,9-,10?/m1/s1 |
| InChIKey | QOBLVZNWRIJRDB-FXOGZNHRSA-N |
| XLogP | -1.75 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |