C30H37NO2 — CID 71260067
(8S,13S,14S,15R,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13,15-dimethyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 71260067) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is (8S,13S,14S,15R,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13,15-dimethyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S,15R,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13,15-dimethyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 71260067 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | (8S,13S,14S,15R,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13,15-dimethyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)C[C@@H](C)[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3C(c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C30H37NO2/c1-6-15-30(33)17-19(2)28-25-13-9-21-16-23(32)12-14-24(21)27(25)26(18-29(28,30)3)20-7-10-22(11-8-20)31(4)5/h7-8,10-11,16,19,25-26,28,33H,9,12-14,17-18H2,1-5H3/t19-,25-,26?,28+,29+,30+/m1/s1 |
| InChIKey | UDDNOMUDVJWVNC-XKUAYQFVSA-N |
| XLogP | 5.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|