C20H28FN3O7 — CID 71270693
(2S)-2-[[[(5S)-5-carboxy-5-[(4-fluorophenyl)methylamino]pentyl]-methylcarbamoyl]amino]pentanedioic acid (PubChem CID 71270693) has the molecular formula C20H28FN3O7 and a molecular weight of 441.46 g/mol. Its IUPAC name is (2S)-2-[[[(5S)-5-carboxy-5-[(4-fluorophenyl)methylamino]pentyl]-methylcarbamoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[(5S)-5-carboxy-5-[(4-fluorophenyl)methylamino]pentyl]-methylcarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 71270693 |
| Molecular Formula | C20H28FN3O7 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (2S)-2-[[[(5S)-5-carboxy-5-[(4-fluorophenyl)methylamino]pentyl]-methylcarbamoyl]amino]pentanedioic acid |
| SMILES | CN(CCCC[C@H](NCc1ccc(F)cc1)C(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H28FN3O7/c1-24(20(31)23-16(19(29)30)9-10-17(25)26)11-3-2-4-15(18(27)28)22-12-13-5-7-14(21)8-6-13/h5-8,15-16,22H,2-4,9-12H2,1H3,(H,23,31)(H,25,26)(H,27,28)(H,29,30)/t15-,16-/m0/s1 |
| InChIKey | UHLMSBOHTLUSMM-HOTGVXAUSA-N |
| XLogP | 1.50 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|