C42H38N3O10P3 — CID 71274514
4-[[4-(4-carboxyphenoxy)-2,4,6,6-tetrakis(4-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-2,4,6-trien-2-yl]oxy]benzoic acid (PubChem CID 71274514) has the molecular formula C42H38N3O10P3 and a molecular weight of 837.70 g/mol. Its IUPAC name is 4-[[4-(4-carboxyphenoxy)-2,4,6,6-tetrakis(4-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-2,4,6-trien-2-yl]oxy]benzoic acid.
| Compound Name | 4-[[4-(4-carboxyphenoxy)-2,4,6,6-tetrakis(4-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-2,4,6-trien-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 71274514 |
| Molecular Formula | C42H38N3O10P3 |
| Molecular Weight | 837.70 g/mol |
| Exact Mass | 837.18 |
| IUPAC Name | 4-[[4-(4-carboxyphenoxy)-2,4,6,6-tetrakis(4-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-2,4,6-trien-2-yl]oxy]benzoic acid |
| SMILES | Cc1ccc(OP2(Oc3ccc(C)cc3)=NP(Oc3ccc(C)cc3)(Oc3ccc(C(=O)O)cc3)=NP(Oc3ccc(C)cc3)(Oc3ccc(C(=O)O)cc3)=N2)cc1 |
| InChI | InChI=1S/C42H38N3O10P3/c1-29-5-17-35(18-6-29)50-56(51-36-19-7-30(2)8-20-36)43-57(52-37-21-9-31(3)10-22-37,54-39-25-13-33(14-26-39)41(46)47)45-58(44-56,53-38-23-11-32(4)12-24-38)55-40-27-15-34(16-28-40)42(48)49/h5-28H,1-4H3,(H,46,47)(H,48,49) |
| InChIKey | RSNPYZLDGHQVLQ-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 167.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.70 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|