C19H25N5O5S — CID 71275772
(3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 71275772) has the molecular formula C19H25N5O5S and a molecular weight of 435.51 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 71275772 |
| Molecular Formula | C19H25N5O5S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-[(2-methoxyphenoxy)methyl]triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CCNC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](Cn3cc(COc4ccccc4OC)nn3)O[C@@H]2S1 |
| InChI | InChI=1S/C19H25N5O5S/c1-3-20-19-21-15-17(26)16(25)14(29-18(15)30-19)9-24-8-11(22-23-24)10-28-13-7-5-4-6-12(13)27-2/h4-8,14-18,25-26H,3,9-10H2,1-2H3,(H,20,21)/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | VLBYINHDUDWITR-DUQPFJRNSA-N |
| XLogP | 0.39 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |