C17H30N2O — CID 71277092
1-[[(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]cyclohexane-1-carboxamide (PubChem CID 71277092) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-[[(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-[[(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71277092 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-[[(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(CC2CCCN3CCCC[C@H]23)CCCCC1 |
| InChI | InChI=1S/C17H30N2O/c18-16(20)17(9-3-1-4-10-17)13-14-7-6-12-19-11-5-2-8-15(14)19/h14-15H,1-13H2,(H2,18,20)/t14?,15-/m1/s1 |
| InChIKey | QFHUWTNWTCTFNT-YSSOQSIOSA-N |
| XLogP | 3.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |