C36H37FN6O3Si — CID 71279858
2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71279858) has the molecular formula C36H37FN6O3Si and a molecular weight of 648.81 g/mol. Its IUPAC name is 2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71279858 |
| Molecular Formula | C36H37FN6O3Si |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | 2-[1-(1-benzhydrylazetidin-3-yl)-6-fluoroindazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)c2nc(-c3nn(C4CN(C(c5ccccc5)c5ccccc5)C4)c4cc(F)ccc34)cnc21 |
| InChI | InChI=1S/C36H37FN6O3Si/c1-47(2,3)17-16-46-23-42-22-29(36(44)45)33-35(42)38-19-30(39-33)32-28-15-14-26(37)18-31(28)43(40-32)27-20-41(21-27)34(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-15,18-19,22,27,34H,16-17,20-21,23H2,1-3H3,(H,44,45) |
| InChIKey | GNJODSVGUYGQJE-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|