C42H40F2N6O4S — CID 71280563
N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-methylsulfonylpropyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280563) has the molecular formula C42H40F2N6O4S and a molecular weight of 762.88 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-methylsulfonylpropyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-methylsulfonylpropyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280563 |
| Molecular Formula | C42H40F2N6O4S |
| Molecular Weight | 762.88 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-methylsulfonylpropyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(-c3nn(CCCS(C)(=O)=O)c4ccc(OC(F)F)cc34)nc12 |
| InChI | InChI=1S/C42H40F2N6O4S/c1-41(2,3)47-39(51)33-27-49(42(28-15-8-5-9-16-28,29-17-10-6-11-18-29)30-19-12-7-13-20-30)38-37(33)46-34(26-45-38)36-32-25-31(54-40(43)44)21-22-35(32)50(48-36)23-14-24-55(4,52)53/h5-13,15-22,25-27,40H,14,23-24H2,1-4H3,(H,47,51) |
| InChIKey | RFGHJIGIXAEFSU-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.88 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|