C42H38F2N6O3 — CID 71280886
N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxobutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280886) has the molecular formula C42H38F2N6O3 and a molecular weight of 712.80 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxobutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxobutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280886 |
| Molecular Formula | C42H38F2N6O3 |
| Molecular Weight | 712.80 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | N-tert-butyl-2-[5-(difluoromethoxy)-1-(3-oxobutyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(=O)CCn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C42H38F2N6O3/c1-27(51)22-23-50-35-21-20-31(53-40(43)44)24-32(35)36(48-50)34-25-45-38-37(46-34)33(39(52)47-41(2,3)4)26-49(38)42(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-21,24-26,40H,22-23H2,1-4H3,(H,47,52) |
| InChIKey | FAHZWVJNROBCBZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.80 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|