C18H26NO3- — CID 7128717
1-(adamantane-1-carbonylamino)cyclohexane-1-carboxylate (PubChem CID 7128717) has the molecular formula C18H26NO3- and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-(adamantane-1-carbonylamino)cyclohexane-1-carboxylate.
| Compound Name | 1-(adamantane-1-carbonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7128717 |
| Molecular Formula | C18H26NO3- |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-(adamantane-1-carbonylamino)cyclohexane-1-carboxylate |
| SMILES | O=C(NC1(C(=O)[O-])CCCCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H27NO3/c20-15(19-18(16(21)22)4-2-1-3-5-18)17-9-12-6-13(10-17)8-14(7-12)11-17/h12-14H,1-11H2,(H,19,20)(H,21,22)/p-1 |
| InChIKey | JIJJGDPXVLGLKT-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |