C19H20N2OS2 — CID 71290572
3-(4-butylphenyl)-5-(4-methylphenyl)sulfinyl-1,2,4-thiadiazole (PubChem CID 71290572) has the molecular formula C19H20N2OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 3-(4-butylphenyl)-5-(4-methylphenyl)sulfinyl-1,2,4-thiadiazole.
| Compound Name | 3-(4-butylphenyl)-5-(4-methylphenyl)sulfinyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 71290572 |
| Molecular Formula | C19H20N2OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-(4-butylphenyl)-5-(4-methylphenyl)sulfinyl-1,2,4-thiadiazole |
| SMILES | CCCCc1ccc(-c2nsc(S(=O)c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C19H20N2OS2/c1-3-4-5-15-8-10-16(11-9-15)18-20-19(23-21-18)24(22)17-12-6-14(2)7-13-17/h6-13H,3-5H2,1-2H3 |
| InChIKey | YMZQSTICNSOALC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |