C24H34N2O3Si — CID 71294561
tert-butyl-[4-[ethoxy-(6-ethoxy-1H-benzimidazol-2-yl)methyl]phenoxy]-dimethylsilane (PubChem CID 71294561) has the molecular formula C24H34N2O3Si and a molecular weight of 426.63 g/mol. Its IUPAC name is tert-butyl-[4-[ethoxy-(6-ethoxy-1H-benzimidazol-2-yl)methyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[ethoxy-(6-ethoxy-1H-benzimidazol-2-yl)methyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71294561 |
| Molecular Formula | C24H34N2O3Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl-[4-[ethoxy-(6-ethoxy-1H-benzimidazol-2-yl)methyl]phenoxy]-dimethylsilane |
| SMILES | CCOc1ccc2nc(C(OCC)c3ccc(O[Si](C)(C)C(C)(C)C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H34N2O3Si/c1-8-27-19-14-15-20-21(16-19)26-23(25-20)22(28-9-2)17-10-12-18(13-11-17)29-30(6,7)24(3,4)5/h10-16,22H,8-9H2,1-7H3,(H,25,26) |
| InChIKey | DTLGGUAYGRNKRT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|