C24H21F2IN2O2 — CID 89436472
2-[[4-[(2,5-difluorophenyl)methoxy]phenyl]-ethoxymethyl]-6-(iodomethyl)-1H-benzimidazole (PubChem CID 89436472) has the molecular formula C24H21F2IN2O2 and a molecular weight of 534.34 g/mol. Its IUPAC name is 2-[[4-[(2,5-difluorophenyl)methoxy]phenyl]-ethoxymethyl]-6-(iodomethyl)-1H-benzimidazole.
| Compound Name | 2-[[4-[(2,5-difluorophenyl)methoxy]phenyl]-ethoxymethyl]-6-(iodomethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 89436472 |
| Molecular Formula | C24H21F2IN2O2 |
| Molecular Weight | 534.34 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 2-[[4-[(2,5-difluorophenyl)methoxy]phenyl]-ethoxymethyl]-6-(iodomethyl)-1H-benzimidazole |
| SMILES | CCOC(c1ccc(OCc2cc(F)ccc2F)cc1)c1nc2ccc(CI)cc2[nH]1 |
| InChI | InChI=1S/C24H21F2IN2O2/c1-2-30-23(24-28-21-10-3-15(13-27)11-22(21)29-24)16-4-7-19(8-5-16)31-14-17-12-18(25)6-9-20(17)26/h3-12,23H,2,13-14H2,1H3,(H,28,29) |
| InChIKey | FMVNEEKYGQZCDY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.34 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|