C24H22F4N2O5S — CID 89428526
2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole;4-methylbenzenesulfonic acid (PubChem CID 89428526) has the molecular formula C24H22F4N2O5S and a molecular weight of 526.51 g/mol. Its IUPAC name is 2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole;4-methylbenzenesulfonic acid.
| Compound Name | 2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89428526 |
| Molecular Formula | C24H22F4N2O5S |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole;4-methylbenzenesulfonic acid |
| SMILES | CCOC(c1ccc(OC(F)(F)F)cc1)c1nc2ccc(F)cc2[nH]1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H14F4N2O2.C7H8O3S/c1-2-24-15(10-3-6-12(7-4-10)25-17(19,20)21)16-22-13-8-5-11(18)9-14(13)23-16;1-6-2-4-7(5-3-6)11(8,9)10/h3-9,15H,2H2,1H3,(H,22,23);2-5H,1H3,(H,8,9,10) |
| InChIKey | DKIVBZCNWQUEIU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|