C23H20F4N2O5S — CID 89428218
benzenesulfonic acid;2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole (PubChem CID 89428218) has the molecular formula C23H20F4N2O5S and a molecular weight of 512.48 g/mol. Its IUPAC name is benzenesulfonic acid;2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole.
| Compound Name | benzenesulfonic acid;2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 89428218 |
| Molecular Formula | C23H20F4N2O5S |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | benzenesulfonic acid;2-[ethoxy-[4-(trifluoromethoxy)phenyl]methyl]-6-fluoro-1H-benzimidazole |
| SMILES | CCOC(c1ccc(OC(F)(F)F)cc1)c1nc2ccc(F)cc2[nH]1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C17H14F4N2O2.C6H6O3S/c1-2-24-15(10-3-6-12(7-4-10)25-17(19,20)21)16-22-13-8-5-11(18)9-14(13)23-16;7-10(8,9)6-4-2-1-3-5-6/h3-9,15H,2H2,1H3,(H,22,23);1-5H,(H,7,8,9) |
| InChIKey | ZEVKMLVHYQKKIU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|