C10H12ClN5O2S — CID 71296489
3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 71296489) has the molecular formula C10H12ClN5O2S and a molecular weight of 301.76 g/mol. Its IUPAC name is 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 71296489 |
| Molecular Formula | C10H12ClN5O2S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCc1nnc(NC(=O)CCc2nc(CCl)no2)s1 |
| InChI | InChI=1S/C10H12ClN5O2S/c1-2-9-14-15-10(19-9)13-7(17)3-4-8-12-6(5-11)16-18-8/h2-5H2,1H3,(H,13,15,17) |
| InChIKey | WGCKPZPVQXCFLS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|