C11H21Cl2N3O — CID 71298828
2-(1-methyl-3-piperidin-3-ylpyrazol-5-yl)ethanol;dihydrochloride (PubChem CID 71298828) has the molecular formula C11H21Cl2N3O and a molecular weight of 282.21 g/mol. Its IUPAC name is 2-(1-methyl-3-piperidin-3-ylpyrazol-5-yl)ethanol;dihydrochloride.
| Compound Name | 2-(1-methyl-3-piperidin-3-ylpyrazol-5-yl)ethanol;dihydrochloride |
|---|---|
| PubChem CID | 71298828 |
| Molecular Formula | C11H21Cl2N3O |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(1-methyl-3-piperidin-3-ylpyrazol-5-yl)ethanol;dihydrochloride |
| SMILES | Cl.Cl.Cn1nc(C2CCCNC2)cc1CCO |
| InChI | InChI=1S/C11H19N3O.2ClH/c1-14-10(4-6-15)7-11(13-14)9-3-2-5-12-8-9;;/h7,9,12,15H,2-6,8H2,1H3;2*1H |
| InChIKey | HGAUANXBWMFESN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |