C7H14Cl2N4 — CID 71299989
4-(1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride (PubChem CID 71299989) has the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride.
| Compound Name | 4-(1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride |
|---|---|
| PubChem CID | 71299989 |
| Molecular Formula | C7H14Cl2N4 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-yl)piperidine;dihydrochloride |
| SMILES | Cl.Cl.c1n[nH]c(C2CCNCC2)n1 |
| InChI | InChI=1S/C7H12N4.2ClH/c1-3-8-4-2-6(1)7-9-5-10-11-7;;/h5-6,8H,1-4H2,(H,9,10,11);2*1H |
| InChIKey | AFHJFIXCEFHUHT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |