C7H8N4O3 — CID 71303637
N-(4-amino-1-methyl-2,6-dioxopyrimidin-5-ylidene)acetamide (PubChem CID 71303637) has the molecular formula C7H8N4O3 and a molecular weight of 196.17 g/mol. Its IUPAC name is N-(4-amino-1-methyl-2,6-dioxopyrimidin-5-ylidene)acetamide.
| Compound Name | N-(4-amino-1-methyl-2,6-dioxopyrimidin-5-ylidene)acetamide |
|---|---|
| PubChem CID | 71303637 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | N-(4-amino-1-methyl-2,6-dioxopyrimidin-5-ylidene)acetamide |
| SMILES | CC(=O)/N=C1\C(=O)N(C)C(=O)N=C1N |
| InChI | InChI=1S/C7H8N4O3/c1-3(12)9-4-5(8)10-7(14)11(2)6(4)13/h1-2H3,(H2,8,10,14)/b9-4- |
| InChIKey | VTPAKQDCCJJYBJ-WTKPLQERSA-N |
| XLogP | -1.08 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|