C7H7ClN4O2 — CID 139636572
1,8-dimethylpurine-2,6-dione;hydrochloride (PubChem CID 139636572) has the molecular formula C7H7ClN4O2 and a molecular weight of 214.61 g/mol. Its IUPAC name is 1,8-dimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 1,8-dimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 139636572 |
| Molecular Formula | C7H7ClN4O2 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 1,8-dimethylpurine-2,6-dione;hydrochloride |
| SMILES | CC1=NC2=NC(=O)N(C)C(=O)C2=N1.Cl |
| InChI | InChI=1S/C7H6N4O2.ClH/c1-3-8-4-5(9-3)10-7(13)11(2)6(4)12;/h1-2H3;1H |
| InChIKey | AGDDKULUXLLUOL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 74.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |