About methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride
methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride (PubChem CID 71306688) has the molecular formula C5H8ClNO2S
and a molecular weight of 181.64 g/mol. Its IUPAC name is methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride.
Analyze methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride?
The IUPAC name of methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride (CID 71306688) is methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride?
The canonical SMILES for methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride is COC(=O)C1CSC=N1.Cl.
What is the InChIKey of methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride?
The InChIKey is OGUFNVNMPNSOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S.ClH/c1-8-5(7)4-2-9-3-6-4;/h3-4H,2H2,1H3;1H.
What are the key properties of methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride?
methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride has a molecular weight of 181.64 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,5-dihydro-1,3-thiazole-4-carboxylate;hydrochloride is sourced from PubChem (CID 71306688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).