About (~2~H_4_)Pyridine-2-carboxylic acid
(~2~H_4_)Pyridine-2-carboxylic acid (PubChem CID 71308975) has the molecular formula C6H5NO2
and a molecular weight of 127.13 g/mol. Its IUPAC name is 3,4,5,6-tetradeuteriopyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | (~2~H_4_)Pyridine-2-carboxylic acid |
| PubChem CID | 71308975 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 127.13 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 3,4,5,6-tetradeuteriopyridine-2-carboxylic acid |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C(=O)O)[2H])[2H] |
| InChI | InChI=1S/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9)/i1D,2D,3D,4D |
| InChIKey | SIOXPEMLGUPBBT-RHQRLBAQSA-N |
| XLogP | 0.80 |
| TPSA | 50.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 114 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (~2~H_4_)Pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (~2~H_4_)Pyridine-2-carboxylic acid?
The IUPAC name of (~2~H_4_)Pyridine-2-carboxylic acid (CID 71308975) is 3,4,5,6-tetradeuteriopyridine-2-carboxylic acid.
What is the SMILES notation for (~2~H_4_)Pyridine-2-carboxylic acid?
The canonical SMILES for (~2~H_4_)Pyridine-2-carboxylic acid is [2H]C1=C(C(=NC(=C1[2H])C(=O)O)[2H])[2H].
What is the InChIKey of (~2~H_4_)Pyridine-2-carboxylic acid?
The InChIKey is SIOXPEMLGUPBBT-RHQRLBAQSA-N. The full InChI is InChI=1S/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9)/i1D,2D,3D,4D.
What are the key properties of (~2~H_4_)Pyridine-2-carboxylic acid?
(~2~H_4_)Pyridine-2-carboxylic acid has a molecular weight of 127.13 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (~2~H_4_)Pyridine-2-carboxylic acid is sourced from PubChem (CID 71308975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).