C9H22NO6P — CID 71317128
cyclohexanamine;2,3-dihydroxypropyl dihydrogen phosphate (PubChem CID 71317128) has the molecular formula C9H22NO6P and a molecular weight of 271.25 g/mol. Its IUPAC name is cyclohexanamine;2,3-dihydroxypropyl dihydrogen phosphate.
| Compound Name | cyclohexanamine;2,3-dihydroxypropyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71317128 |
| Molecular Formula | C9H22NO6P |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | cyclohexanamine;2,3-dihydroxypropyl dihydrogen phosphate |
| SMILES | NC1CCCCC1.O=P(O)(O)OCC(O)CO |
| InChI | InChI=1S/C6H13N.C3H9O6P/c7-6-4-2-1-3-5-6;4-1-3(5)2-9-10(6,7)8/h6H,1-5,7H2;3-5H,1-2H2,(H2,6,7,8) |
| InChIKey | KRPIJKAIDSXSIO-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|