C14H10ClN3O3 — CID 71323109
6-chloro-4-(3,4-dimethylphenoxy)-5-nitropyridine-3-carbonitrile (PubChem CID 71323109) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.71 g/mol. Its IUPAC name is 6-chloro-4-(3,4-dimethylphenoxy)-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-chloro-4-(3,4-dimethylphenoxy)-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71323109 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 6-chloro-4-(3,4-dimethylphenoxy)-5-nitropyridine-3-carbonitrile |
| SMILES | Cc1ccc(Oc2c(C#N)cnc(Cl)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H10ClN3O3/c1-8-3-4-11(5-9(8)2)21-13-10(6-16)7-17-14(15)12(13)18(19)20/h3-5,7H,1-2H3 |
| InChIKey | HJYMUUWMCMQNJE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|