C16H28O6 — CID 71324178
2,3-diethoxy-4-octoxy-4-oxobut-2-enoic acid (PubChem CID 71324178) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2,3-diethoxy-4-octoxy-4-oxobut-2-enoic acid.
| Compound Name | 2,3-diethoxy-4-octoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 71324178 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2,3-diethoxy-4-octoxy-4-oxobut-2-enoic acid |
| SMILES | CCCCCCCCOC(=O)C(OCC)=C(OCC)C(=O)O |
| InChI | InChI=1S/C16H28O6/c1-4-7-8-9-10-11-12-22-16(19)14(21-6-3)13(15(17)18)20-5-2/h4-12H2,1-3H3,(H,17,18) |
| InChIKey | VMBNSMHJYFDVQL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|