C12H19NO2 — CID 71346465
1-phenyl-3-(propan-2-ylamino)propane-1,2-diol (PubChem CID 71346465) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-phenyl-3-(propan-2-ylamino)propane-1,2-diol.
| Compound Name | 1-phenyl-3-(propan-2-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 71346465 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-phenyl-3-(propan-2-ylamino)propane-1,2-diol |
| SMILES | CC(C)NCC(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO2/c1-9(2)13-8-11(14)12(15)10-6-4-3-5-7-10/h3-7,9,11-15H,8H2,1-2H3 |
| InChIKey | ODVNVVXLZAALLK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |