C10H7N3O2 — CID 71357535
1-([1,2,5]oxadiazolo[3,4-b]indol-4-yl)ethanone (PubChem CID 71357535) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is 1-([1,2,5]oxadiazolo[3,4-b]indol-4-yl)ethanone.
| Compound Name | 1-([1,2,5]oxadiazolo[3,4-b]indol-4-yl)ethanone |
|---|---|
| PubChem CID | 71357535 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 1-([1,2,5]oxadiazolo[3,4-b]indol-4-yl)ethanone |
| SMILES | CC(=O)n1c2ccccc2c2nonc21 |
| InChI | InChI=1S/C10H7N3O2/c1-6(14)13-8-5-3-2-4-7(8)9-10(13)12-15-11-9/h2-5H,1H3 |
| InChIKey | XTDUWWSXZABVMW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |