About 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine
1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine (PubChem CID 71360479) has the molecular formula C11H18Cl3NSi2
and a molecular weight of 326.80 g/mol. Its IUPAC name is 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine.
Molecular Properties
| Compound Name | 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine |
| PubChem CID | 71360479 |
| Molecular Formula | C11H18Cl3NSi2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine |
| SMILES | CC(c1ccccc1)N([Si](C)(C)C)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NSi2/c1-10(11-8-6-5-7-9-11)15(16(2,3)4)17(12,13)14/h5-10H,1-4H3 |
| InChIKey | KEJBPOXJSSKXJP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine?
The IUPAC name of 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine (CID 71360479) is 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine.
What is the SMILES notation for 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine?
The canonical SMILES for 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine is CC(c1ccccc1)N([Si](C)(C)C)[Si](Cl)(Cl)Cl.
What is the InChIKey of 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine?
The InChIKey is KEJBPOXJSSKXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18Cl3NSi2/c1-10(11-8-6-5-7-9-11)15(16(2,3)4)17(12,13)14/h5-10H,1-4H3.
What are the key properties of 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine?
1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine has a molecular weight of 326.80 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-trichlorosilyl-N-trimethylsilylethanamine is sourced from PubChem (CID 71360479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).