C12H17N3S — CID 71366333
N-(piperidin-1-ylmethyl)pyridine-2-carbothioamide (PubChem CID 71366333) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N-(piperidin-1-ylmethyl)pyridine-2-carbothioamide.
| Compound Name | N-(piperidin-1-ylmethyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 71366333 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-(piperidin-1-ylmethyl)pyridine-2-carbothioamide |
| SMILES | S=C(NCN1CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C12H17N3S/c16-12(11-6-2-3-7-13-11)14-10-15-8-4-1-5-9-15/h2-3,6-7H,1,4-5,8-10H2,(H,14,16) |
| InChIKey | ZSSSKXPQMMVBDO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|