About 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene
8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 71370015) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 71370015 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C#CCCC1=C(C)CC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H18O2/c1-3-4-5-12-6-7-13(10-11(12)2)14-8-9-15-13/h1H,4-10H2,2H3 |
| InChIKey | HXUXHWSKDWDKBH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene (CID 71370015) is 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene is C#CCCC1=C(C)CC2(CC1)OCCO2.
What is the InChIKey of 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene?
The InChIKey is HXUXHWSKDWDKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-4-5-12-6-7-13(10-11(12)2)14-8-9-15-13/h1H,4-10H2,2H3.
What are the key properties of 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene?
8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene has a molecular weight of 206.28 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-but-3-ynyl-7-methyl-1,4-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 71370015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).