C11H12Cl2O — CID 71378688
2,4-bis(chloromethyl)-1-prop-2-enoxybenzene (PubChem CID 71378688) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 2,4-bis(chloromethyl)-1-prop-2-enoxybenzene.
| Compound Name | 2,4-bis(chloromethyl)-1-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 71378688 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2,4-bis(chloromethyl)-1-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(CCl)cc1CCl |
| InChI | InChI=1S/C11H12Cl2O/c1-2-5-14-11-4-3-9(7-12)6-10(11)8-13/h2-4,6H,1,5,7-8H2 |
| InChIKey | HOGJAFWFXQDZIH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|