C16H12Cl2N2O3S — CID 71388848
[2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]phenyl] acetate (PubChem CID 71388848) has the molecular formula C16H12Cl2N2O3S and a molecular weight of 383.26 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]phenyl] acetate.
| Compound Name | [2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 71388848 |
| Molecular Formula | C16H12Cl2N2O3S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O3S/c1-9(21)23-14-5-3-2-4-11(14)15(22)20-16(24)19-10-6-7-12(17)13(18)8-10/h2-8H,1H3,(H2,19,20,22,24) |
| InChIKey | HHQSFOABQFZTCM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|