C17H11Cl2F3N2O3S — CID 71673742
2,2,2-trifluoroethyl 2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]benzoate (PubChem CID 71673742) has the molecular formula C17H11Cl2F3N2O3S and a molecular weight of 451.25 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]benzoate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 71673742 |
| Molecular Formula | C17H11Cl2F3N2O3S |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(3,4-dichlorophenyl)carbamothioylcarbamoyl]benzoate |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)c(Cl)c1)c1ccccc1C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C17H11Cl2F3N2O3S/c18-12-6-5-9(7-13(12)19)23-16(28)24-14(25)10-3-1-2-4-11(10)15(26)27-8-17(20,21)22/h1-7H,8H2,(H2,23,24,25,28) |
| InChIKey | NQODUMLBEQPYPI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|